C13H19NO4S2 — CID 79819218
cycloheptyl 4-methyl-5-sulfamoylthiophene-3-carboxylate (PubChem CID 79819218) has the molecular formula C13H19NO4S2 and a molecular weight of 317.43 g/mol. Its IUPAC name is cycloheptyl 4-methyl-5-sulfamoylthiophene-3-carboxylate.
| Compound Name | cycloheptyl 4-methyl-5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 79819218 |
| Molecular Formula | C13H19NO4S2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | cycloheptyl 4-methyl-5-sulfamoylthiophene-3-carboxylate |
| SMILES | Cc1c(C(=O)OC2CCCCCC2)csc1S(N)(=O)=O |
| InChI | InChI=1S/C13H19NO4S2/c1-9-11(8-19-13(9)20(14,16)17)12(15)18-10-6-4-2-3-5-7-10/h8,10H,2-7H2,1H3,(H2,14,16,17) |
| InChIKey | GYUKDRUKRUFKSZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |