C12H19NO5S2 — CID 106668745
(3-methoxy-3-methylbutyl) 4-methyl-5-sulfamoylthiophene-3-carboxylate (PubChem CID 106668745) has the molecular formula C12H19NO5S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (3-methoxy-3-methylbutyl) 4-methyl-5-sulfamoylthiophene-3-carboxylate.
| Compound Name | (3-methoxy-3-methylbutyl) 4-methyl-5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 106668745 |
| Molecular Formula | C12H19NO5S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | (3-methoxy-3-methylbutyl) 4-methyl-5-sulfamoylthiophene-3-carboxylate |
| SMILES | COC(C)(C)CCOC(=O)c1csc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C12H19NO5S2/c1-8-9(7-19-11(8)20(13,15)16)10(14)18-6-5-12(2,3)17-4/h7H,5-6H2,1-4H3,(H2,13,15,16) |
| InChIKey | VVNUOZOMDTYSGR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |