C11H17NO5S2 — CID 79818645
2-propan-2-yloxyethyl 4-methyl-5-sulfamoylthiophene-3-carboxylate (PubChem CID 79818645) has the molecular formula C11H17NO5S2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 4-methyl-5-sulfamoylthiophene-3-carboxylate.
| Compound Name | 2-propan-2-yloxyethyl 4-methyl-5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 79818645 |
| Molecular Formula | C11H17NO5S2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2-propan-2-yloxyethyl 4-methyl-5-sulfamoylthiophene-3-carboxylate |
| SMILES | Cc1c(C(=O)OCCOC(C)C)csc1S(N)(=O)=O |
| InChI | InChI=1S/C11H17NO5S2/c1-7(2)16-4-5-17-10(13)9-6-18-11(8(9)3)19(12,14)15/h6-7H,4-5H2,1-3H3,(H2,12,14,15) |
| InChIKey | XMAPTGUKPZWHMX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|