C14H24N2O3S2 — CID 102915529
4-methyl-N-(3-methyl-2-propan-2-ylbutyl)-5-sulfamoylthiophene-3-carboxamide (PubChem CID 102915529) has the molecular formula C14H24N2O3S2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 4-methyl-N-(3-methyl-2-propan-2-ylbutyl)-5-sulfamoylthiophene-3-carboxamide.
| Compound Name | 4-methyl-N-(3-methyl-2-propan-2-ylbutyl)-5-sulfamoylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 102915529 |
| Molecular Formula | C14H24N2O3S2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 4-methyl-N-(3-methyl-2-propan-2-ylbutyl)-5-sulfamoylthiophene-3-carboxamide |
| SMILES | Cc1c(C(=O)NCC(C(C)C)C(C)C)csc1S(N)(=O)=O |
| InChI | InChI=1S/C14H24N2O3S2/c1-8(2)11(9(3)4)6-16-13(17)12-7-20-14(10(12)5)21(15,18)19/h7-9,11H,6H2,1-5H3,(H,16,17)(H2,15,18,19) |
| InChIKey | FCCFYXKKYCURCE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |