About N-(3,3-dimethylbutan-2-yl)-4-methyl-5-sulfamoylthiophene-3-carboxamide
N-(3,3-dimethylbutan-2-yl)-4-methyl-5-sulfamoylthiophene-3-carboxamide (PubChem CID 104830396) has the molecular formula C12H20N2O3S2
and a molecular weight of 304.44 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-4-methyl-5-sulfamoylthiophene-3-carboxamide.
Molecular Properties
| Compound Name | N-(3,3-dimethylbutan-2-yl)-4-methyl-5-sulfamoylthiophene-3-carboxamide |
| PubChem CID | 104830396 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-4-methyl-5-sulfamoylthiophene-3-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)C(C)(C)C)csc1S(N)(=O)=O |
| InChI | InChI=1S/C12H20N2O3S2/c1-7-9(6-18-11(7)19(13,16)17)10(15)14-8(2)12(3,4)5/h6,8H,1-5H3,(H,14,15)(H2,13,16,17) |
| InChIKey | DHNRCTKSSURHSF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,3-dimethylbutan-2-yl)-4-methyl-5-sulfamoylthiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylbutan-2-yl)-4-methyl-5-sulfamoylthiophene-3-carboxamide?
The IUPAC name of N-(3,3-dimethylbutan-2-yl)-4-methyl-5-sulfamoylthiophene-3-carboxamide (CID 104830396) is N-(3,3-dimethylbutan-2-yl)-4-methyl-5-sulfamoylthiophene-3-carboxamide.
What is the SMILES notation for N-(3,3-dimethylbutan-2-yl)-4-methyl-5-sulfamoylthiophene-3-carboxamide?
The canonical SMILES for N-(3,3-dimethylbutan-2-yl)-4-methyl-5-sulfamoylthiophene-3-carboxamide is Cc1c(C(=O)NC(C)C(C)(C)C)csc1S(N)(=O)=O.
What is the InChIKey of N-(3,3-dimethylbutan-2-yl)-4-methyl-5-sulfamoylthiophene-3-carboxamide?
The InChIKey is DHNRCTKSSURHSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O3S2/c1-7-9(6-18-11(7)19(13,16)17)10(15)14-8(2)12(3,4)5/h6,8H,1-5H3,(H,14,15)(H2,13,16,17).
What are the key properties of N-(3,3-dimethylbutan-2-yl)-4-methyl-5-sulfamoylthiophene-3-carboxamide?
N-(3,3-dimethylbutan-2-yl)-4-methyl-5-sulfamoylthiophene-3-carboxamide has a molecular weight of 304.44 g/mol, XLogP of 1.87, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylbutan-2-yl)-4-methyl-5-sulfamoylthiophene-3-carboxamide is sourced from PubChem (CID 104830396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).