C10H15NO5S2 — CID 60721282
2-propan-2-yloxyethyl 5-sulfamoylthiophene-3-carboxylate (PubChem CID 60721282) has the molecular formula C10H15NO5S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 5-sulfamoylthiophene-3-carboxylate.
| Compound Name | 2-propan-2-yloxyethyl 5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 60721282 |
| Molecular Formula | C10H15NO5S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-propan-2-yloxyethyl 5-sulfamoylthiophene-3-carboxylate |
| SMILES | CC(C)OCCOC(=O)c1csc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H15NO5S2/c1-7(2)15-3-4-16-10(12)8-5-9(17-6-8)18(11,13)14/h5-7H,3-4H2,1-2H3,(H2,11,13,14) |
| InChIKey | CCNRGYFMMAPLIG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|