About 2-propan-2-yloxyethyl 4-bromo-3-chlorosulfonylbenzoate
2-propan-2-yloxyethyl 4-bromo-3-chlorosulfonylbenzoate (PubChem CID 65375458) has the molecular formula C12H14BrClO5S
and a molecular weight of 385.66 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 4-bromo-3-chlorosulfonylbenzoate.
Molecular Properties
| Compound Name | 2-propan-2-yloxyethyl 4-bromo-3-chlorosulfonylbenzoate |
| PubChem CID | 65375458 |
| Molecular Formula | C12H14BrClO5S |
| Molecular Weight | 385.66 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 2-propan-2-yloxyethyl 4-bromo-3-chlorosulfonylbenzoate |
| SMILES | CC(C)OCCOC(=O)c1ccc(Br)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C12H14BrClO5S/c1-8(2)18-5-6-19-12(15)9-3-4-10(13)11(7-9)20(14,16)17/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | ZDHBOWHUJYGDEJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.66 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yloxyethyl 4-bromo-3-chlorosulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxyethyl 4-bromo-3-chlorosulfonylbenzoate?
The IUPAC name of 2-propan-2-yloxyethyl 4-bromo-3-chlorosulfonylbenzoate (CID 65375458) is 2-propan-2-yloxyethyl 4-bromo-3-chlorosulfonylbenzoate.
What is the SMILES notation for 2-propan-2-yloxyethyl 4-bromo-3-chlorosulfonylbenzoate?
The canonical SMILES for 2-propan-2-yloxyethyl 4-bromo-3-chlorosulfonylbenzoate is CC(C)OCCOC(=O)c1ccc(Br)c(S(=O)(=O)Cl)c1.
What is the InChIKey of 2-propan-2-yloxyethyl 4-bromo-3-chlorosulfonylbenzoate?
The InChIKey is ZDHBOWHUJYGDEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrClO5S/c1-8(2)18-5-6-19-12(15)9-3-4-10(13)11(7-9)20(14,16)17/h3-4,7-8H,5-6H2,1-2H3.
What are the key properties of 2-propan-2-yloxyethyl 4-bromo-3-chlorosulfonylbenzoate?
2-propan-2-yloxyethyl 4-bromo-3-chlorosulfonylbenzoate has a molecular weight of 385.66 g/mol, XLogP of 2.96, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxyethyl 4-bromo-3-chlorosulfonylbenzoate is sourced from PubChem (CID 65375458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).