C10H14BrNO6S — CID 65382070
2-propan-2-yloxyethyl 5-bromo-4-sulfamoylfuran-2-carboxylate (PubChem CID 65382070) has the molecular formula C10H14BrNO6S and a molecular weight of 356.19 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 5-bromo-4-sulfamoylfuran-2-carboxylate.
| Compound Name | 2-propan-2-yloxyethyl 5-bromo-4-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 65382070 |
| Molecular Formula | C10H14BrNO6S |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | 2-propan-2-yloxyethyl 5-bromo-4-sulfamoylfuran-2-carboxylate |
| SMILES | CC(C)OCCOC(=O)c1cc(S(N)(=O)=O)c(Br)o1 |
| InChI | InChI=1S/C10H14BrNO6S/c1-6(2)16-3-4-17-10(13)7-5-8(9(11)18-7)19(12,14)15/h5-6H,3-4H2,1-2H3,(H2,12,14,15) |
| InChIKey | RQVSZBHWERJSDC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|