C11H16BrNO7S — CID 103181676
2-(3-methoxypropoxy)ethyl 5-bromo-4-sulfamoylfuran-2-carboxylate (PubChem CID 103181676) has the molecular formula C11H16BrNO7S and a molecular weight of 386.22 g/mol. Its IUPAC name is 2-(3-methoxypropoxy)ethyl 5-bromo-4-sulfamoylfuran-2-carboxylate.
| Compound Name | 2-(3-methoxypropoxy)ethyl 5-bromo-4-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 103181676 |
| Molecular Formula | C11H16BrNO7S |
| Molecular Weight | 386.22 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | 2-(3-methoxypropoxy)ethyl 5-bromo-4-sulfamoylfuran-2-carboxylate |
| SMILES | COCCCOCCOC(=O)c1cc(S(N)(=O)=O)c(Br)o1 |
| InChI | InChI=1S/C11H16BrNO7S/c1-17-3-2-4-18-5-6-19-11(14)8-7-9(10(12)20-8)21(13,15)16/h7H,2-6H2,1H3,(H2,13,15,16) |
| InChIKey | VBLVNCBPWHHDBC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|