C11H17BrN2O5S — CID 65388437
5-bromo-N-(2-butoxyethyl)-4-sulfamoylfuran-2-carboxamide (PubChem CID 65388437) has the molecular formula C11H17BrN2O5S and a molecular weight of 369.24 g/mol. Its IUPAC name is 5-bromo-N-(2-butoxyethyl)-4-sulfamoylfuran-2-carboxamide.
| Compound Name | 5-bromo-N-(2-butoxyethyl)-4-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 65388437 |
| Molecular Formula | C11H17BrN2O5S |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 5-bromo-N-(2-butoxyethyl)-4-sulfamoylfuran-2-carboxamide |
| SMILES | CCCCOCCNC(=O)c1cc(S(N)(=O)=O)c(Br)o1 |
| InChI | InChI=1S/C11H17BrN2O5S/c1-2-3-5-18-6-4-14-11(15)8-7-9(10(12)19-8)20(13,16)17/h7H,2-6H2,1H3,(H,14,15)(H2,13,16,17) |
| InChIKey | MVPBXAOZLAXDMX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|