C9H13BrN2O5S — CID 65387444
5-bromo-N-(2-methoxyethyl)-N-methyl-4-sulfamoylfuran-2-carboxamide (PubChem CID 65387444) has the molecular formula C9H13BrN2O5S and a molecular weight of 341.18 g/mol. Its IUPAC name is 5-bromo-N-(2-methoxyethyl)-N-methyl-4-sulfamoylfuran-2-carboxamide.
| Compound Name | 5-bromo-N-(2-methoxyethyl)-N-methyl-4-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 65387444 |
| Molecular Formula | C9H13BrN2O5S |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 5-bromo-N-(2-methoxyethyl)-N-methyl-4-sulfamoylfuran-2-carboxamide |
| SMILES | COCCN(C)C(=O)c1cc(S(N)(=O)=O)c(Br)o1 |
| InChI | InChI=1S/C9H13BrN2O5S/c1-12(3-4-16-2)9(13)6-5-7(8(10)17-6)18(11,14)15/h5H,3-4H2,1-2H3,(H2,11,14,15) |
| InChIKey | LZHPGAXSRNWACW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |