C13H17BrN2O4S — CID 65381791
5-bromo-N,N-bis(cyclopropylmethyl)-4-sulfamoylfuran-2-carboxamide (PubChem CID 65381791) has the molecular formula C13H17BrN2O4S and a molecular weight of 377.26 g/mol. Its IUPAC name is 5-bromo-N,N-bis(cyclopropylmethyl)-4-sulfamoylfuran-2-carboxamide.
| Compound Name | 5-bromo-N,N-bis(cyclopropylmethyl)-4-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 65381791 |
| Molecular Formula | C13H17BrN2O4S |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 5-bromo-N,N-bis(cyclopropylmethyl)-4-sulfamoylfuran-2-carboxamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)N(CC2CC2)CC2CC2)oc1Br |
| InChI | InChI=1S/C13H17BrN2O4S/c14-12-11(21(15,18)19)5-10(20-12)13(17)16(6-8-1-2-8)7-9-3-4-9/h5,8-9H,1-4,6-7H2,(H2,15,18,19) |
| InChIKey | IBYLZYMFYXKMQF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |