C14H20N2O3S2 — CID 115629451
N,N-bis(cyclopropylmethyl)-5-methyl-4-sulfamoylthiophene-2-carboxamide (PubChem CID 115629451) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N,N-bis(cyclopropylmethyl)-5-methyl-4-sulfamoylthiophene-2-carboxamide.
| Compound Name | N,N-bis(cyclopropylmethyl)-5-methyl-4-sulfamoylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 115629451 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N,N-bis(cyclopropylmethyl)-5-methyl-4-sulfamoylthiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)N(CC2CC2)CC2CC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C14H20N2O3S2/c1-9-13(21(15,18)19)6-12(20-9)14(17)16(7-10-2-3-10)8-11-4-5-11/h6,10-11H,2-5,7-8H2,1H3,(H2,15,18,19) |
| InChIKey | CEJRPTHLPWVZBS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |