About N-butyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide
N-butyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide (PubChem CID 112689667) has the molecular formula C11H18N2O3S2
and a molecular weight of 290.41 g/mol. Its IUPAC name is N-butyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-butyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide |
| PubChem CID | 112689667 |
| Molecular Formula | C11H18N2O3S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-butyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide |
| SMILES | CCCCN(C)C(=O)c1cc(S(N)(=O)=O)c(C)s1 |
| InChI | InChI=1S/C11H18N2O3S2/c1-4-5-6-13(3)11(14)9-7-10(8(2)17-9)18(12,15)16/h7H,4-6H2,1-3H3,(H2,12,15,16) |
| InChIKey | ABXRQGDFMYCOPO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide?
The IUPAC name of N-butyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide (CID 112689667) is N-butyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide.
What is the SMILES notation for N-butyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide?
The canonical SMILES for N-butyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide is CCCCN(C)C(=O)c1cc(S(N)(=O)=O)c(C)s1.
What is the InChIKey of N-butyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide?
The InChIKey is ABXRQGDFMYCOPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3S2/c1-4-5-6-13(3)11(14)9-7-10(8(2)17-9)18(12,15)16/h7H,4-6H2,1-3H3,(H2,12,15,16).
What are the key properties of N-butyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide?
N-butyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide has a molecular weight of 290.41 g/mol, XLogP of 1.58, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide is sourced from PubChem (CID 112689667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).