C11H18N2O3S2 — CID 112689693
N-(2,2-dimethylpropyl)-5-methyl-4-sulfamoylthiophene-2-carboxamide (PubChem CID 112689693) has the molecular formula C11H18N2O3S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-5-methyl-4-sulfamoylthiophene-2-carboxamide.
| Compound Name | N-(2,2-dimethylpropyl)-5-methyl-4-sulfamoylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 112689693 |
| Molecular Formula | C11H18N2O3S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-(2,2-dimethylpropyl)-5-methyl-4-sulfamoylthiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)NCC(C)(C)C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H18N2O3S2/c1-7-9(18(12,15)16)5-8(17-7)10(14)13-6-11(2,3)4/h5H,6H2,1-4H3,(H,13,14)(H2,12,15,16) |
| InChIKey | GDKQPMRWXHXOSH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |