C11H18N2O4S3 — CID 115729501
5-methyl-N-(3-methylsulfinylbutyl)-4-sulfamoylthiophene-2-carboxamide (PubChem CID 115729501) has the molecular formula C11H18N2O4S3 and a molecular weight of 338.48 g/mol. Its IUPAC name is 5-methyl-N-(3-methylsulfinylbutyl)-4-sulfamoylthiophene-2-carboxamide.
| Compound Name | 5-methyl-N-(3-methylsulfinylbutyl)-4-sulfamoylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 115729501 |
| Molecular Formula | C11H18N2O4S3 |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 5-methyl-N-(3-methylsulfinylbutyl)-4-sulfamoylthiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)NCCC(C)S(C)=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H18N2O4S3/c1-7(19(3)15)4-5-13-11(14)9-6-10(8(2)18-9)20(12,16)17/h6-7H,4-5H2,1-3H3,(H,13,14)(H2,12,16,17) |
| InChIKey | MIFVNVNAWUEHOK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |