C14H22N2O3S2 — CID 115612428
N-(2-cyclohexylethyl)-5-methyl-4-sulfamoylthiophene-2-carboxamide (PubChem CID 115612428) has the molecular formula C14H22N2O3S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-5-methyl-4-sulfamoylthiophene-2-carboxamide.
| Compound Name | N-(2-cyclohexylethyl)-5-methyl-4-sulfamoylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 115612428 |
| Molecular Formula | C14H22N2O3S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | N-(2-cyclohexylethyl)-5-methyl-4-sulfamoylthiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)NCCC2CCCCC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C14H22N2O3S2/c1-10-13(21(15,18)19)9-12(20-10)14(17)16-8-7-11-5-3-2-4-6-11/h9,11H,2-8H2,1H3,(H,16,17)(H2,15,18,19) |
| InChIKey | HGUQBGZEERESOJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |