C10H14N2O3S2 — CID 112689679
N-cyclopropyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide (PubChem CID 112689679) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is N-cyclopropyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide.
| Compound Name | N-cyclopropyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 112689679 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | N-cyclopropyl-N,5-dimethyl-4-sulfamoylthiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)N(C)C2CC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H14N2O3S2/c1-6-9(17(11,14)15)5-8(16-6)10(13)12(2)7-3-4-7/h5,7H,3-4H2,1-2H3,(H2,11,14,15) |
| InChIKey | DZNIGQVRSNCMIS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |