C12H20N2O3S2 — CID 112676812
N,5-dimethyl-N-pentyl-4-sulfamoylthiophene-2-carboxamide (PubChem CID 112676812) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is N,5-dimethyl-N-pentyl-4-sulfamoylthiophene-2-carboxamide.
| Compound Name | N,5-dimethyl-N-pentyl-4-sulfamoylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 112676812 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N,5-dimethyl-N-pentyl-4-sulfamoylthiophene-2-carboxamide |
| SMILES | CCCCCN(C)C(=O)c1cc(S(N)(=O)=O)c(C)s1 |
| InChI | InChI=1S/C12H20N2O3S2/c1-4-5-6-7-14(3)12(15)10-8-11(9(2)18-10)19(13,16)17/h8H,4-7H2,1-3H3,(H2,13,16,17) |
| InChIKey | RSUCQAGPOAXJQI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|