C13H19ClN2O3S — CID 82890834
N-butyl-5-chloro-N,2-dimethyl-3-sulfamoylbenzamide (PubChem CID 82890834) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is N-butyl-5-chloro-N,2-dimethyl-3-sulfamoylbenzamide.
| Compound Name | N-butyl-5-chloro-N,2-dimethyl-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 82890834 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-butyl-5-chloro-N,2-dimethyl-3-sulfamoylbenzamide |
| SMILES | CCCCN(C)C(=O)c1cc(Cl)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C13H19ClN2O3S/c1-4-5-6-16(3)13(17)11-7-10(14)8-12(9(11)2)20(15,18)19/h7-8H,4-6H2,1-3H3,(H2,15,18,19) |
| InChIKey | CIUMHXLQSOQKNZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |