C11H14ClNO3S2 — CID 112676774
5-(2-cyclopropylethylcarbamoyl)-2-methylthiophene-3-sulfonyl chloride (PubChem CID 112676774) has the molecular formula C11H14ClNO3S2 and a molecular weight of 307.82 g/mol. Its IUPAC name is 5-(2-cyclopropylethylcarbamoyl)-2-methylthiophene-3-sulfonyl chloride.
| Compound Name | 5-(2-cyclopropylethylcarbamoyl)-2-methylthiophene-3-sulfonyl chloride |
|---|---|
| PubChem CID | 112676774 |
| Molecular Formula | C11H14ClNO3S2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 5-(2-cyclopropylethylcarbamoyl)-2-methylthiophene-3-sulfonyl chloride |
| SMILES | Cc1sc(C(=O)NCCC2CC2)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H14ClNO3S2/c1-7-10(18(12,15)16)6-9(17-7)11(14)13-5-4-8-2-3-8/h6,8H,2-5H2,1H3,(H,13,14) |
| InChIKey | WGIYKEUAQCBWQQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |