C12H18ClNO3S2 — CID 112676753
5-(hexan-3-ylcarbamoyl)-2-methylthiophene-3-sulfonyl chloride (PubChem CID 112676753) has the molecular formula C12H18ClNO3S2 and a molecular weight of 323.87 g/mol. Its IUPAC name is 5-(hexan-3-ylcarbamoyl)-2-methylthiophene-3-sulfonyl chloride.
| Compound Name | 5-(hexan-3-ylcarbamoyl)-2-methylthiophene-3-sulfonyl chloride |
|---|---|
| PubChem CID | 112676753 |
| Molecular Formula | C12H18ClNO3S2 |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 5-(hexan-3-ylcarbamoyl)-2-methylthiophene-3-sulfonyl chloride |
| SMILES | CCCC(CC)NC(=O)c1cc(S(=O)(=O)Cl)c(C)s1 |
| InChI | InChI=1S/C12H18ClNO3S2/c1-4-6-9(5-2)14-12(15)10-7-11(8(3)18-10)19(13,16)17/h7,9H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | XVQMGEZQHQFATK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |