C13H18ClNO3S2 — CID 115994032
5-[cyclopropylmethyl(propyl)carbamoyl]-2-methylthiophene-3-sulfonyl chloride (PubChem CID 115994032) has the molecular formula C13H18ClNO3S2 and a molecular weight of 335.88 g/mol. Its IUPAC name is 5-[cyclopropylmethyl(propyl)carbamoyl]-2-methylthiophene-3-sulfonyl chloride.
| Compound Name | 5-[cyclopropylmethyl(propyl)carbamoyl]-2-methylthiophene-3-sulfonyl chloride |
|---|---|
| PubChem CID | 115994032 |
| Molecular Formula | C13H18ClNO3S2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 5-[cyclopropylmethyl(propyl)carbamoyl]-2-methylthiophene-3-sulfonyl chloride |
| SMILES | CCCN(CC1CC1)C(=O)c1cc(S(=O)(=O)Cl)c(C)s1 |
| InChI | InChI=1S/C13H18ClNO3S2/c1-3-6-15(8-10-4-5-10)13(16)11-7-12(9(2)19-11)20(14,17)18/h7,10H,3-6,8H2,1-2H3 |
| InChIKey | GFQWWEQIHAYVAR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |