C14H19ClO4S2 — CID 115994120
(2-ethylcyclohexyl) 4-chlorosulfonyl-5-methylthiophene-2-carboxylate (PubChem CID 115994120) has the molecular formula C14H19ClO4S2 and a molecular weight of 350.89 g/mol. Its IUPAC name is (2-ethylcyclohexyl) 4-chlorosulfonyl-5-methylthiophene-2-carboxylate.
| Compound Name | (2-ethylcyclohexyl) 4-chlorosulfonyl-5-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 115994120 |
| Molecular Formula | C14H19ClO4S2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | (2-ethylcyclohexyl) 4-chlorosulfonyl-5-methylthiophene-2-carboxylate |
| SMILES | CCC1CCCCC1OC(=O)c1cc(S(=O)(=O)Cl)c(C)s1 |
| InChI | InChI=1S/C14H19ClO4S2/c1-3-10-6-4-5-7-11(10)19-14(16)12-8-13(9(2)20-12)21(15,17)18/h8,10-11H,3-7H2,1-2H3 |
| InChIKey | UQILWWVQYUZNRU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |