C10H9ClF3NO3S2 — CID 106219395
2-methyl-5-[[1-(trifluoromethyl)cyclopropyl]carbamoyl]thiophene-3-sulfonyl chloride (PubChem CID 106219395) has the molecular formula C10H9ClF3NO3S2 and a molecular weight of 347.77 g/mol. Its IUPAC name is 2-methyl-5-[[1-(trifluoromethyl)cyclopropyl]carbamoyl]thiophene-3-sulfonyl chloride.
| Compound Name | 2-methyl-5-[[1-(trifluoromethyl)cyclopropyl]carbamoyl]thiophene-3-sulfonyl chloride |
|---|---|
| PubChem CID | 106219395 |
| Molecular Formula | C10H9ClF3NO3S2 |
| Molecular Weight | 347.77 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | 2-methyl-5-[[1-(trifluoromethyl)cyclopropyl]carbamoyl]thiophene-3-sulfonyl chloride |
| SMILES | Cc1sc(C(=O)NC2(C(F)(F)F)CC2)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H9ClF3NO3S2/c1-5-7(20(11,17)18)4-6(19-5)8(16)15-9(2-3-9)10(12,13)14/h4H,2-3H2,1H3,(H,15,16) |
| InChIKey | BNUPPJHUNASKCN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.77 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |