C13H20N2O4S2 — CID 115729503
4-methyl-N-(3-methylsulfinylbutyl)-3-sulfamoylbenzamide (PubChem CID 115729503) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-methyl-N-(3-methylsulfinylbutyl)-3-sulfamoylbenzamide.
| Compound Name | 4-methyl-N-(3-methylsulfinylbutyl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 115729503 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 4-methyl-N-(3-methylsulfinylbutyl)-3-sulfamoylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCC(C)S(C)=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C13H20N2O4S2/c1-9-4-5-11(8-12(9)21(14,18)19)13(16)15-7-6-10(2)20(3)17/h4-5,8,10H,6-7H2,1-3H3,(H,15,16)(H2,14,18,19) |
| InChIKey | PZAJYAHEKCNQNB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |