C12H15F3N2O3S — CID 104855003
4-methyl-3-sulfamoyl-N-(4,4,4-trifluorobutan-2-yl)benzamide (PubChem CID 104855003) has the molecular formula C12H15F3N2O3S and a molecular weight of 324.32 g/mol. Its IUPAC name is 4-methyl-3-sulfamoyl-N-(4,4,4-trifluorobutan-2-yl)benzamide.
| Compound Name | 4-methyl-3-sulfamoyl-N-(4,4,4-trifluorobutan-2-yl)benzamide |
|---|---|
| PubChem CID | 104855003 |
| Molecular Formula | C12H15F3N2O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 4-methyl-3-sulfamoyl-N-(4,4,4-trifluorobutan-2-yl)benzamide |
| SMILES | Cc1ccc(C(=O)NC(C)CC(F)(F)F)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H15F3N2O3S/c1-7-3-4-9(5-10(7)21(16,19)20)11(18)17-8(2)6-12(13,14)15/h3-5,8H,6H2,1-2H3,(H,17,18)(H2,16,19,20) |
| InChIKey | XHPFCUOAXULYJQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |