C12H13F4NO — CID 113461612
4-fluoro-3-methyl-N-(4,4,4-trifluorobutan-2-yl)benzamide (PubChem CID 113461612) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-(4,4,4-trifluorobutan-2-yl)benzamide.
| Compound Name | 4-fluoro-3-methyl-N-(4,4,4-trifluorobutan-2-yl)benzamide |
|---|---|
| PubChem CID | 113461612 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 4-fluoro-3-methyl-N-(4,4,4-trifluorobutan-2-yl)benzamide |
| SMILES | Cc1cc(C(=O)NC(C)CC(F)(F)F)ccc1F |
| InChI | InChI=1S/C12H13F4NO/c1-7-5-9(3-4-10(7)13)11(18)17-8(2)6-12(14,15)16/h3-5,8H,6H2,1-2H3,(H,17,18) |
| InChIKey | VBKOHYADTJFELE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |