C14H20FNOS — CID 113245327
N-(4-ethylsulfanylbutan-2-yl)-4-fluoro-3-methylbenzamide (PubChem CID 113245327) has the molecular formula C14H20FNOS and a molecular weight of 269.38 g/mol. Its IUPAC name is N-(4-ethylsulfanylbutan-2-yl)-4-fluoro-3-methylbenzamide.
| Compound Name | N-(4-ethylsulfanylbutan-2-yl)-4-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 113245327 |
| Molecular Formula | C14H20FNOS |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-(4-ethylsulfanylbutan-2-yl)-4-fluoro-3-methylbenzamide |
| SMILES | CCSCCC(C)NC(=O)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C14H20FNOS/c1-4-18-8-7-11(3)16-14(17)12-5-6-13(15)10(2)9-12/h5-6,9,11H,4,7-8H2,1-3H3,(H,16,17) |
| InChIKey | CYTBYWQWSWEUAJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|