C13H16F3NOS — CID 113245328
N-(4-ethylsulfanylbutan-2-yl)-3,4,5-trifluorobenzamide (PubChem CID 113245328) has the molecular formula C13H16F3NOS and a molecular weight of 291.34 g/mol. Its IUPAC name is N-(4-ethylsulfanylbutan-2-yl)-3,4,5-trifluorobenzamide.
| Compound Name | N-(4-ethylsulfanylbutan-2-yl)-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 113245328 |
| Molecular Formula | C13H16F3NOS |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-(4-ethylsulfanylbutan-2-yl)-3,4,5-trifluorobenzamide |
| SMILES | CCSCCC(C)NC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H16F3NOS/c1-3-19-5-4-8(2)17-13(18)9-6-10(14)12(16)11(15)7-9/h6-8H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | QMACPBPJRILYPC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|