C13H16F2N2O3S — CID 103740722
N-(4-ethylsulfanylbutan-2-yl)-2,6-difluoro-3-nitrobenzamide (PubChem CID 103740722) has the molecular formula C13H16F2N2O3S and a molecular weight of 318.35 g/mol. Its IUPAC name is N-(4-ethylsulfanylbutan-2-yl)-2,6-difluoro-3-nitrobenzamide.
| Compound Name | N-(4-ethylsulfanylbutan-2-yl)-2,6-difluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 103740722 |
| Molecular Formula | C13H16F2N2O3S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-(4-ethylsulfanylbutan-2-yl)-2,6-difluoro-3-nitrobenzamide |
| SMILES | CCSCCC(C)NC(=O)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C13H16F2N2O3S/c1-3-21-7-6-8(2)16-13(18)11-9(14)4-5-10(12(11)15)17(19)20/h4-5,8H,3,6-7H2,1-2H3,(H,16,18) |
| InChIKey | UZAIFGKWHDKCCX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|