C12H12F2N2O5 — CID 79757786
ethyl 2-[(2,6-difluoro-3-nitrobenzoyl)amino]propanoate (PubChem CID 79757786) has the molecular formula C12H12F2N2O5 and a molecular weight of 302.23 g/mol. Its IUPAC name is ethyl 2-[(2,6-difluoro-3-nitrobenzoyl)amino]propanoate.
| Compound Name | ethyl 2-[(2,6-difluoro-3-nitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 79757786 |
| Molecular Formula | C12H12F2N2O5 |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | ethyl 2-[(2,6-difluoro-3-nitrobenzoyl)amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C12H12F2N2O5/c1-3-21-12(18)6(2)15-11(17)9-7(13)4-5-8(10(9)14)16(19)20/h4-6H,3H2,1-2H3,(H,15,17) |
| InChIKey | FINYIQCIOHHHKY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|