C12H15FN4O4 — CID 107123111
2-amino-N-[1-(ethylamino)-1-oxopropan-2-yl]-6-fluoro-3-nitrobenzamide (PubChem CID 107123111) has the molecular formula C12H15FN4O4 and a molecular weight of 298.27 g/mol. Its IUPAC name is 2-amino-N-[1-(ethylamino)-1-oxopropan-2-yl]-6-fluoro-3-nitrobenzamide.
| Compound Name | 2-amino-N-[1-(ethylamino)-1-oxopropan-2-yl]-6-fluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 107123111 |
| Molecular Formula | C12H15FN4O4 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-amino-N-[1-(ethylamino)-1-oxopropan-2-yl]-6-fluoro-3-nitrobenzamide |
| SMILES | CCNC(=O)C(C)NC(=O)c1c(F)ccc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C12H15FN4O4/c1-3-15-11(18)6(2)16-12(19)9-7(13)4-5-8(10(9)14)17(20)21/h4-6H,3,14H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | LGLHGXOGFIKGQF-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|