C12H16FN3O3 — CID 107122826
2-amino-6-fluoro-N-(3-methylbutyl)-3-nitrobenzamide (PubChem CID 107122826) has the molecular formula C12H16FN3O3 and a molecular weight of 269.28 g/mol. Its IUPAC name is 2-amino-6-fluoro-N-(3-methylbutyl)-3-nitrobenzamide.
| Compound Name | 2-amino-6-fluoro-N-(3-methylbutyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 107122826 |
| Molecular Formula | C12H16FN3O3 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-amino-6-fluoro-N-(3-methylbutyl)-3-nitrobenzamide |
| SMILES | CC(C)CCNC(=O)c1c(F)ccc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C12H16FN3O3/c1-7(2)5-6-15-12(17)10-8(13)3-4-9(11(10)14)16(18)19/h3-4,7H,5-6,14H2,1-2H3,(H,15,17) |
| InChIKey | NBWQHUFKRLCKQT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|