C10H8F2N6O3 — CID 79758317
2,6-difluoro-3-nitro-N-[1-(2H-tetrazol-5-yl)ethyl]benzamide (PubChem CID 79758317) has the molecular formula C10H8F2N6O3 and a molecular weight of 298.21 g/mol. Its IUPAC name is 2,6-difluoro-3-nitro-N-[1-(2H-tetrazol-5-yl)ethyl]benzamide.
| Compound Name | 2,6-difluoro-3-nitro-N-[1-(2H-tetrazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 79758317 |
| Molecular Formula | C10H8F2N6O3 |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2,6-difluoro-3-nitro-N-[1-(2H-tetrazol-5-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1c(F)ccc([N+](=O)[O-])c1F)c1nn[nH]n1 |
| InChI | InChI=1S/C10H8F2N6O3/c1-4(9-14-16-17-15-9)13-10(19)7-5(11)2-3-6(8(7)12)18(20)21/h2-4H,1H3,(H,13,19)(H,14,15,16,17) |
| InChIKey | HRCFVJWNUAJLTG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|