C14H17F4NOS — CID 115697220
N-(4-ethylsulfanylbutan-2-yl)-2-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 115697220) has the molecular formula C14H17F4NOS and a molecular weight of 323.36 g/mol. Its IUPAC name is N-(4-ethylsulfanylbutan-2-yl)-2-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-(4-ethylsulfanylbutan-2-yl)-2-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 115697220 |
| Molecular Formula | C14H17F4NOS |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-(4-ethylsulfanylbutan-2-yl)-2-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | CCSCCC(C)NC(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C14H17F4NOS/c1-3-21-7-6-9(2)19-13(20)11-8-10(14(16,17)18)4-5-12(11)15/h4-5,8-9H,3,6-7H2,1-2H3,(H,19,20) |
| InChIKey | SODRYVWUGWHWPT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|