C13H15F4NOS — CID 115900410
2-fluoro-N-(1-methylsulfanylbutan-2-yl)-5-(trifluoromethyl)benzamide (PubChem CID 115900410) has the molecular formula C13H15F4NOS and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-fluoro-N-(1-methylsulfanylbutan-2-yl)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-N-(1-methylsulfanylbutan-2-yl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 115900410 |
| Molecular Formula | C13H15F4NOS |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-fluoro-N-(1-methylsulfanylbutan-2-yl)-5-(trifluoromethyl)benzamide |
| SMILES | CCC(CSC)NC(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H15F4NOS/c1-3-9(7-20-2)18-12(19)10-6-8(13(15,16)17)4-5-11(10)14/h4-6,9H,3,7H2,1-2H3,(H,18,19) |
| InChIKey | IMXPRLAVMUHWKY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |