C12H11F4NO4 — CID 107821699
(2S)-2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]-4-hydroxybutanoic acid (PubChem CID 107821699) has the molecular formula C12H11F4NO4 and a molecular weight of 309.22 g/mol. Its IUPAC name is (2S)-2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107821699 |
| Molecular Formula | C12H11F4NO4 |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (2S)-2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]-4-hydroxybutanoic acid |
| SMILES | O=C(N[C@@H](CCO)C(=O)O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C12H11F4NO4/c13-8-2-1-6(12(14,15)16)5-7(8)10(19)17-9(3-4-18)11(20)21/h1-2,5,9,18H,3-4H2,(H,17,19)(H,20,21)/t9-/m0/s1 |
| InChIKey | OAYAILBIJGKTJH-VIFPVBQESA-N |
| XLogP | 1.41 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |