C11H11F2NO4 — CID 61242712
2-[(3,4-difluorobenzoyl)amino]-4-hydroxybutanoic acid (PubChem CID 61242712) has the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. Its IUPAC name is 2-[(3,4-difluorobenzoyl)amino]-4-hydroxybutanoic acid.
| Compound Name | 2-[(3,4-difluorobenzoyl)amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 61242712 |
| Molecular Formula | C11H11F2NO4 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-[(3,4-difluorobenzoyl)amino]-4-hydroxybutanoic acid |
| SMILES | O=C(NC(CCO)C(=O)O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H11F2NO4/c12-7-2-1-6(5-8(7)13)10(16)14-9(3-4-15)11(17)18/h1-2,5,9,15H,3-4H2,(H,14,16)(H,17,18) |
| InChIKey | XAJSNYRGFGVNLK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |