C11H10F3NO4 — CID 107822093
(2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid (PubChem CID 107822093) has the molecular formula C11H10F3NO4 and a molecular weight of 277.20 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 107822093 |
| Molecular Formula | C11H10F3NO4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | (2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid |
| SMILES | O=C(N[C@@H](CCO)C(=O)O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H10F3NO4/c12-6-2-1-5(8(13)9(6)14)10(17)15-7(3-4-16)11(18)19/h1-2,7,16H,3-4H2,(H,15,17)(H,18,19)/t7-/m0/s1 |
| InChIKey | XZWJQECRKQHPFW-ZETCQYMHSA-N |
| XLogP | 0.67 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|