(2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid

C11H10F3NO4 — CID 107822093

IUPAC(2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid
SMILESO=C(N[C@@H](CCO)C(=O)O)c1ccc(F)c(F)c1F
InChIInChI=1S/C11H10F3NO4/c12-6-2-1-5(8(13)9(6)14)10(17)15-7(3-4-16)11(18)19/h1-2,7,16H,3-4H2,(H,15,17)(H,18,19)/t7-/m0/s1
InChIKeyXZWJQECRKQHPFW-ZETCQYMHSA-N
MW277.20 g/mol
LogP0.67
Rot. Bonds5

About (2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid

(2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid (PubChem CID 107822093) has the molecular formula C11H10F3NO4 and a molecular weight of 277.20 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid.

Molecular Properties

Compound Name(2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid
PubChem CID107822093
Molecular FormulaC11H10F3NO4
Molecular Weight277.20 g/mol
Exact Mass277.06
IUPAC Name(2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid
SMILESO=C(N[C@@H](CCO)C(=O)O)c1ccc(F)c(F)c1F
InChIInChI=1S/C11H10F3NO4/c12-6-2-1-5(8(13)9(6)14)10(17)15-7(3-4-16)11(18)19/h1-2,7,16H,3-4H2,(H,15,17)(H,18,19)/t7-/m0/s1
InChIKeyXZWJQECRKQHPFW-ZETCQYMHSA-N
XLogP0.67
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.20
LogP ≤ 50.67
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze (2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid?
The IUPAC name of (2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid (CID 107822093) is (2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid.
What is the SMILES notation for (2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid?
The canonical SMILES for (2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid is O=C(N[C@@H](CCO)C(=O)O)c1ccc(F)c(F)c1F.
What is the InChIKey of (2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid?
The InChIKey is XZWJQECRKQHPFW-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H10F3NO4/c12-6-2-1-5(8(13)9(6)14)10(17)15-7(3-4-16)11(18)19/h1-2,7,16H,3-4H2,(H,15,17)(H,18,19)/t7-/m0/s1.
What are the key properties of (2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid?
(2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid has a molecular weight of 277.20 g/mol, XLogP of 0.67, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-hydroxy-2-[(2,3,4-trifluorobenzoyl)amino]butanoic acid is sourced from PubChem (CID 107822093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).