C11H11ClFNO4 — CID 114004822
(2S)-2-[(2-chloro-3-fluorobenzoyl)amino]-4-hydroxybutanoic acid (PubChem CID 114004822) has the molecular formula C11H11ClFNO4 and a molecular weight of 275.66 g/mol. Its IUPAC name is (2S)-2-[(2-chloro-3-fluorobenzoyl)amino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[(2-chloro-3-fluorobenzoyl)amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 114004822 |
| Molecular Formula | C11H11ClFNO4 |
| Molecular Weight | 275.66 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | (2S)-2-[(2-chloro-3-fluorobenzoyl)amino]-4-hydroxybutanoic acid |
| SMILES | O=C(N[C@@H](CCO)C(=O)O)c1cccc(F)c1Cl |
| InChI | InChI=1S/C11H11ClFNO4/c12-9-6(2-1-3-7(9)13)10(16)14-8(4-5-15)11(17)18/h1-3,8,15H,4-5H2,(H,14,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | NJTOWLASTMQQFJ-QMMMGPOBSA-N |
| XLogP | 1.04 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.66 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |