C11H11ClFNO4 — CID 81462130
methyl 2-[(2-chloro-3-fluorobenzoyl)amino]-3-hydroxypropanoate (PubChem CID 81462130) has the molecular formula C11H11ClFNO4 and a molecular weight of 275.66 g/mol. Its IUPAC name is methyl 2-[(2-chloro-3-fluorobenzoyl)amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[(2-chloro-3-fluorobenzoyl)amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 81462130 |
| Molecular Formula | C11H11ClFNO4 |
| Molecular Weight | 275.66 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | methyl 2-[(2-chloro-3-fluorobenzoyl)amino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NC(=O)c1cccc(F)c1Cl |
| InChI | InChI=1S/C11H11ClFNO4/c1-18-11(17)8(5-15)14-10(16)6-3-2-4-7(13)9(6)12/h2-4,8,15H,5H2,1H3,(H,14,16) |
| InChIKey | RNHSVYRUZDQHQY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.66 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |