C13H15FN2O5 — CID 9277655
methyl (2R)-2-[[2-[(2-fluorobenzoyl)amino]acetyl]amino]-3-hydroxypropanoate (PubChem CID 9277655) has the molecular formula C13H15FN2O5 and a molecular weight of 298.27 g/mol. Its IUPAC name is methyl (2R)-2-[[2-[(2-fluorobenzoyl)amino]acetyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl (2R)-2-[[2-[(2-fluorobenzoyl)amino]acetyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 9277655 |
| Molecular Formula | C13H15FN2O5 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | methyl (2R)-2-[[2-[(2-fluorobenzoyl)amino]acetyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@@H](CO)NC(=O)CNC(=O)c1ccccc1F |
| InChI | InChI=1S/C13H15FN2O5/c1-21-13(20)10(7-17)16-11(18)6-15-12(19)8-4-2-3-5-9(8)14/h2-5,10,17H,6-7H2,1H3,(H,15,19)(H,16,18)/t10-/m1/s1 |
| InChIKey | XCVPZUZOZJLCEP-SNVBAGLBSA-N |
| XLogP | -0.79 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |