C11H11FINO3 — CID 103493166
methyl 3-[(2-fluorobenzoyl)amino]-2-iodopropanoate (PubChem CID 103493166) has the molecular formula C11H11FINO3 and a molecular weight of 351.12 g/mol. Its IUPAC name is methyl 3-[(2-fluorobenzoyl)amino]-2-iodopropanoate.
| Compound Name | methyl 3-[(2-fluorobenzoyl)amino]-2-iodopropanoate |
|---|---|
| PubChem CID | 103493166 |
| Molecular Formula | C11H11FINO3 |
| Molecular Weight | 351.12 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | methyl 3-[(2-fluorobenzoyl)amino]-2-iodopropanoate |
| SMILES | COC(=O)C(I)CNC(=O)c1ccccc1F |
| InChI | InChI=1S/C11H11FINO3/c1-17-11(16)9(13)6-14-10(15)7-4-2-3-5-8(7)12/h2-5,9H,6H2,1H3,(H,14,15) |
| InChIKey | DVYVZIXVJBTPEO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.12 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|