C12H15ClFNO2 — CID 81461590
2-chloro-3-fluoro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzamide (PubChem CID 81461590) has the molecular formula C12H15ClFNO2 and a molecular weight of 259.71 g/mol. Its IUPAC name is 2-chloro-3-fluoro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzamide.
| Compound Name | 2-chloro-3-fluoro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 81461590 |
| Molecular Formula | C12H15ClFNO2 |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-chloro-3-fluoro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzamide |
| SMILES | CC(C)[C@@H](CO)NC(=O)c1cccc(F)c1Cl |
| InChI | InChI=1S/C12H15ClFNO2/c1-7(2)10(6-16)15-12(17)8-4-3-5-9(14)11(8)13/h3-5,7,10,16H,6H2,1-2H3,(H,15,17)/t10-/m1/s1 |
| InChIKey | FPVAHPVZGPEMLW-SNVBAGLBSA-N |
| XLogP | 2.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |