C12H14Cl2FNO2 — CID 79252938
2,4-dichloro-5-fluoro-N-(1-hydroxy-3-methylbutan-2-yl)benzamide (PubChem CID 79252938) has the molecular formula C12H14Cl2FNO2 and a molecular weight of 294.15 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-(1-hydroxy-3-methylbutan-2-yl)benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-(1-hydroxy-3-methylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 79252938 |
| Molecular Formula | C12H14Cl2FNO2 |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-(1-hydroxy-3-methylbutan-2-yl)benzamide |
| SMILES | CC(C)C(CO)NC(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2FNO2/c1-6(2)11(5-17)16-12(18)7-3-10(15)9(14)4-8(7)13/h3-4,6,11,17H,5H2,1-2H3,(H,16,18) |
| InChIKey | KOSNGUGNEXUHET-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|