C10H10Cl2FNO3 — CID 65315016
2,4-dichloro-N-(1,3-dihydroxypropan-2-yl)-5-fluorobenzamide (PubChem CID 65315016) has the molecular formula C10H10Cl2FNO3 and a molecular weight of 282.10 g/mol. Its IUPAC name is 2,4-dichloro-N-(1,3-dihydroxypropan-2-yl)-5-fluorobenzamide.
| Compound Name | 2,4-dichloro-N-(1,3-dihydroxypropan-2-yl)-5-fluorobenzamide |
|---|---|
| PubChem CID | 65315016 |
| Molecular Formula | C10H10Cl2FNO3 |
| Molecular Weight | 282.10 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 2,4-dichloro-N-(1,3-dihydroxypropan-2-yl)-5-fluorobenzamide |
| SMILES | O=C(NC(CO)CO)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl2FNO3/c11-7-2-8(12)9(13)1-6(7)10(17)14-5(3-15)4-16/h1-2,5,15-16H,3-4H2,(H,14,17) |
| InChIKey | UOHCQYCWPWUOPN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.10 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|