C11H10Cl2FNO2 — CID 115764766
2,4-dichloro-5-fluoro-N-[1-(hydroxymethyl)cyclopropyl]benzamide (PubChem CID 115764766) has the molecular formula C11H10Cl2FNO2 and a molecular weight of 278.11 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[1-(hydroxymethyl)cyclopropyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[1-(hydroxymethyl)cyclopropyl]benzamide |
|---|---|
| PubChem CID | 115764766 |
| Molecular Formula | C11H10Cl2FNO2 |
| Molecular Weight | 278.11 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[1-(hydroxymethyl)cyclopropyl]benzamide |
| SMILES | O=C(NC1(CO)CC1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2FNO2/c12-7-4-8(13)9(14)3-6(7)10(17)15-11(5-16)1-2-11/h3-4,16H,1-2,5H2,(H,15,17) |
| InChIKey | GPYWIXLOOJRQDD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.11 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|