C12H12Cl2FNO3S — CID 47114810
2,4-dichloro-5-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide (PubChem CID 47114810) has the molecular formula C12H12Cl2FNO3S and a molecular weight of 340.20 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 47114810 |
| Molecular Formula | C12H12Cl2FNO3S |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide |
| SMILES | CC1(NC(=O)c2cc(F)c(Cl)cc2Cl)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H12Cl2FNO3S/c1-12(2-3-20(18,19)6-12)16-11(17)7-4-10(15)9(14)5-8(7)13/h4-5H,2-3,6H2,1H3,(H,16,17) |
| InChIKey | XOYVIBOPQDREIW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|