C11H13FN2O3S — CID 107358572
2-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-3-carboxamide (PubChem CID 107358572) has the molecular formula C11H13FN2O3S and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-3-carboxamide.
| Compound Name | 2-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107358572 |
| Molecular Formula | C11H13FN2O3S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-3-carboxamide |
| SMILES | CC1(NC(=O)c2cccnc2F)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13FN2O3S/c1-11(4-6-18(16,17)7-11)14-10(15)8-3-2-5-13-9(8)12/h2-3,5H,4,6-7H2,1H3,(H,14,15) |
| InChIKey | ZVXZVZMNTOTLOB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|